About [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane
[2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane (PubChem CID 123737229) has the molecular formula C20H39OS+
and a molecular weight of 327.60 g/mol. Its IUPAC name is [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane.
Molecular Properties
| Compound Name | [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane |
| PubChem CID | 123737229 |
| Molecular Formula | C20H39OS+ |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane |
| SMILES | C=CC(C)CC(C)(CC)C1CC1S([CH2+])(C)C(CC)(CC)OC |
| InChI | InChI=1S/C20H39OS/c1-10-16(5)15-19(6,11-2)17-14-18(17)22(8,9)20(12-3,13-4)21-7/h10,16-18H,1,8,11-15H2,2-7,9H3/q+1 |
| InChIKey | CEBCPAFYAZDAGC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane?
The IUPAC name of [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane (CID 123737229) is [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane.
What is the SMILES notation for [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane?
The canonical SMILES for [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane is C=CC(C)CC(C)(CC)C1CC1S([CH2+])(C)C(CC)(CC)OC.
What is the InChIKey of [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane?
The InChIKey is CEBCPAFYAZDAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39OS/c1-10-16(5)15-19(6,11-2)17-14-18(17)22(8,9)20(12-3,13-4)21-7/h10,16-18H,1,8,11-15H2,2-7,9H3/q+1.
What are the key properties of [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane?
[2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane has a molecular weight of 327.60 g/mol, XLogP of 6.39, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dimethylhept-6-en-3-yl)cyclopropyl]-(3-methoxypentan-3-yl)-methyl-methyl-λ4-sulfane is sourced from PubChem (CID 123737229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).