C18H26N2O4 — CID 123737307
3-ethoxy-N-[1-(4-hydroxy-2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]-N-methylbenzamide (PubChem CID 123737307) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-ethoxy-N-[1-(4-hydroxy-2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]-N-methylbenzamide.
| Compound Name | 3-ethoxy-N-[1-(4-hydroxy-2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123737307 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-ethoxy-N-[1-(4-hydroxy-2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]-N-methylbenzamide |
| SMILES | CCOc1cccc(C(=O)N(C)C(C)C(=O)N2CC(O)CC2C)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-24-16-8-6-7-14(10-16)18(23)19(4)13(3)17(22)20-11-15(21)9-12(20)2/h6-8,10,12-13,15,21H,5,9,11H2,1-4H3 |
| InChIKey | NBEONANXYLRDIF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |