About 5-ethyl-1,3-dioxolane-4-thione
5-ethyl-1,3-dioxolane-4-thione (PubChem CID 123737466) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is 5-ethyl-1,3-dioxolane-4-thione.
Molecular Properties
| Compound Name | 5-ethyl-1,3-dioxolane-4-thione |
| PubChem CID | 123737466 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 5-ethyl-1,3-dioxolane-4-thione |
| SMILES | CCC1OCOC1=S |
| InChI | InChI=1S/C5H8O2S/c1-2-4-5(8)7-3-6-4/h4H,2-3H2,1H3 |
| InChIKey | JCKXFYSRDMXAAE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,3-dioxolane-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-dioxolane-4-thione?
The IUPAC name of 5-ethyl-1,3-dioxolane-4-thione (CID 123737466) is 5-ethyl-1,3-dioxolane-4-thione.
What is the SMILES notation for 5-ethyl-1,3-dioxolane-4-thione?
The canonical SMILES for 5-ethyl-1,3-dioxolane-4-thione is CCC1OCOC1=S.
What is the InChIKey of 5-ethyl-1,3-dioxolane-4-thione?
The InChIKey is JCKXFYSRDMXAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c1-2-4-5(8)7-3-6-4/h4H,2-3H2,1H3.
What are the key properties of 5-ethyl-1,3-dioxolane-4-thione?
5-ethyl-1,3-dioxolane-4-thione has a molecular weight of 132.18 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-dioxolane-4-thione is sourced from PubChem (CID 123737466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).