C20H14F2N2O5 — CID 123737988
N-[5-(2,2-dihydroxy-6-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-2,6-difluorobenzamide (PubChem CID 123737988) has the molecular formula C20H14F2N2O5 and a molecular weight of 400.34 g/mol. Its IUPAC name is N-[5-(2,2-dihydroxy-6-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(2,2-dihydroxy-6-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 123737988 |
| Molecular Formula | C20H14F2N2O5 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[5-(2,2-dihydroxy-6-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc2c(cc1-c1ccc(NC(=O)c3c(F)cccc3F)nc1)OC(O)(O)O2 |
| InChI | InChI=1S/C20H14F2N2O5/c1-10-7-15-16(29-20(26,27)28-15)8-12(10)11-5-6-17(23-9-11)24-19(25)18-13(21)3-2-4-14(18)22/h2-9,26-27H,1H3,(H,23,24,25) |
| InChIKey | OZJKABGVXSPOHJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|