About 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione
5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione (PubChem CID 123738539) has the molecular formula C5H5N4OS+
and a molecular weight of 169.19 g/mol. Its IUPAC name is 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione.
Molecular Properties
| Compound Name | 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione |
| PubChem CID | 123738539 |
| Molecular Formula | C5H5N4OS+ |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione |
| SMILES | Nc1nc2[nH]c(=S)oc2c[nH+]1 |
| InChI | InChI=1S/C5H4N4OS/c6-4-7-1-2-3(8-4)9-5(11)10-2/h1H,(H3,6,7,8,9,11)/p+1 |
| InChIKey | RHYFWQXSDJXJJY-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione?
The IUPAC name of 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione (CID 123738539) is 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione.
What is the SMILES notation for 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione?
The canonical SMILES for 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione is Nc1nc2[nH]c(=S)oc2c[nH+]1.
What is the InChIKey of 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione?
The InChIKey is RHYFWQXSDJXJJY-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H4N4OS/c6-4-7-1-2-3(8-4)9-5(11)10-2/h1H,(H3,6,7,8,9,11)/p+1.
What are the key properties of 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione?
5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione has a molecular weight of 169.19 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3H-[1,3]oxazolo[4,5-d]pyrimidin-6-ium-2-thione is sourced from PubChem (CID 123738539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).