C20H33NO3 — CID 123738552
3-[(2-hydroxyethylamino)methyl]-7-[2-(1-methylcyclopropyl)ethyl]spiro[3a,4,5,7,8,8a-hexahydro-3H-cyclohepta[b]furan-6,1'-cyclopropane]-2-one (PubChem CID 123738552) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-[(2-hydroxyethylamino)methyl]-7-[2-(1-methylcyclopropyl)ethyl]spiro[3a,4,5,7,8,8a-hexahydro-3H-cyclohepta[b]furan-6,1'-cyclopropane]-2-one.
| Compound Name | 3-[(2-hydroxyethylamino)methyl]-7-[2-(1-methylcyclopropyl)ethyl]spiro[3a,4,5,7,8,8a-hexahydro-3H-cyclohepta[b]furan-6,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 123738552 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 3-[(2-hydroxyethylamino)methyl]-7-[2-(1-methylcyclopropyl)ethyl]spiro[3a,4,5,7,8,8a-hexahydro-3H-cyclohepta[b]furan-6,1'-cyclopropane]-2-one |
| SMILES | CC1(CCC2CC3OC(=O)C(CNCCO)C3CCC23CC3)CC1 |
| InChI | InChI=1S/C20H33NO3/c1-19(6-7-19)4-2-14-12-17-15(3-5-20(14)8-9-20)16(18(23)24-17)13-21-10-11-22/h14-17,21-22H,2-13H2,1H3 |
| InChIKey | FZJPRKKCLUUAQF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|