C17H16F3NO — CID 123738879
3-(3,5-difluorophenyl)-1-(3-fluorohepta-1,3,5-trien-4-yl)pyrrolidin-2-one (PubChem CID 123738879) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1-(3-fluorohepta-1,3,5-trien-4-yl)pyrrolidin-2-one.
| Compound Name | 3-(3,5-difluorophenyl)-1-(3-fluorohepta-1,3,5-trien-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 123738879 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1-(3-fluorohepta-1,3,5-trien-4-yl)pyrrolidin-2-one |
| SMILES | C=CC(F)=C(C=CC)N1CCC(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C17H16F3NO/c1-3-5-16(15(20)4-2)21-7-6-14(17(21)22)11-8-12(18)10-13(19)9-11/h3-5,8-10,14H,2,6-7H2,1H3 |
| InChIKey | ONJIRJBHYDBHJN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|