C25H23F2N5O3S — CID 123739734
N-[3-[5-[4-amino-3-(methyliminomethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2,4-difluorophenyl]propane-1-sulfonamide (PubChem CID 123739734) has the molecular formula C25H23F2N5O3S and a molecular weight of 511.55 g/mol. Its IUPAC name is N-[3-[5-[4-amino-3-(methyliminomethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2,4-difluorophenyl]propane-1-sulfonamide.
| Compound Name | N-[3-[5-[4-amino-3-(methyliminomethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2,4-difluorophenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 123739734 |
| Molecular Formula | C25H23F2N5O3S |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[3-[5-[4-amino-3-(methyliminomethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2,4-difluorophenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc(N)c(/C=N/C)c4)cc23)c1F |
| InChI | InChI=1S/C25H23F2N5O3S/c1-3-8-36(34,35)32-21-7-5-19(26)22(23(21)27)24(33)18-13-31-25-17(18)10-15(12-30-25)14-4-6-20(28)16(9-14)11-29-2/h4-7,9-13,32H,3,8,28H2,1-2H3,(H,30,31)/b29-11+ |
| InChIKey | NNIUTZZZMMNAAE-VPUKRXIYSA-N |
| XLogP | 4.52 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|