C14H28N2 — CID 123740297
2-tert-butyl-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine (PubChem CID 123740297) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-tert-butyl-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine.
| Compound Name | 2-tert-butyl-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
|---|---|
| PubChem CID | 123740297 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-tert-butyl-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
| SMILES | CC(C)(C)C1CC2CC(N)CC(C)(C)N2C1 |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)10-6-12-7-11(15)8-14(4,5)16(12)9-10/h10-12H,6-9,15H2,1-5H3 |
| InChIKey | LSEVEWKJFSGNCC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |