C25H29F3O5 — CID 123740629
(5-ethenyl-9-methoxy-5-methyl-15-methylidene-10,16-dioxo-2-pentacyclo[12.2.2.01,12.04,11.09,11]octadecanyl) 2,2,2-trifluoroacetate (PubChem CID 123740629) has the molecular formula C25H29F3O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is (5-ethenyl-9-methoxy-5-methyl-15-methylidene-10,16-dioxo-2-pentacyclo[12.2.2.01,12.04,11.09,11]octadecanyl) 2,2,2-trifluoroacetate.
| Compound Name | (5-ethenyl-9-methoxy-5-methyl-15-methylidene-10,16-dioxo-2-pentacyclo[12.2.2.01,12.04,11.09,11]octadecanyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 123740629 |
| Molecular Formula | C25H29F3O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (5-ethenyl-9-methoxy-5-methyl-15-methylidene-10,16-dioxo-2-pentacyclo[12.2.2.01,12.04,11.09,11]octadecanyl) 2,2,2-trifluoroacetate |
| SMILES | C=CC1(C)CCCC2(OC)C(=O)C23C1CC(OC(=O)C(F)(F)F)C12CCC(CC13)C(=C)C2=O |
| InChI | InChI=1S/C25H29F3O5/c1-5-21(3)8-6-9-23(32-4)19(30)24(23)15(21)12-17(33-20(31)25(26,27)28)22-10-7-14(11-16(22)24)13(2)18(22)29/h5,14-17H,1-2,6-12H2,3-4H3 |
| InChIKey | ZSZMHYRCOMUJJY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|