About 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine
1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine (PubChem CID 123740792) has the molecular formula C8H13N5S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine.
Molecular Properties
| Compound Name | 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine |
| PubChem CID | 123740792 |
| Molecular Formula | C8H13N5S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine |
| SMILES | CN(C)C(N)=N/C(N)=N/c1ccsc1 |
| InChI | InChI=1S/C8H13N5S/c1-13(2)8(10)12-7(9)11-6-3-4-14-5-6/h3-5H,1-2H3,(H4,9,10,11,12) |
| InChIKey | KCLYYRVMTPEQNA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine?
The IUPAC name of 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine (CID 123740792) is 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine.
What is the SMILES notation for 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine?
The canonical SMILES for 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine is CN(C)C(N)=N/C(N)=N/c1ccsc1.
What is the InChIKey of 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine?
The InChIKey is KCLYYRVMTPEQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5S/c1-13(2)8(10)12-7(9)11-6-3-4-14-5-6/h3-5H,1-2H3,(H4,9,10,11,12).
What are the key properties of 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine?
1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine has a molecular weight of 211.29 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2-(N'-thiophen-3-ylcarbamimidoyl)guanidine is sourced from PubChem (CID 123740792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).