C20H20ClNO5S — CID 123741023
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-methyloxane-3,4,5-triol (PubChem CID 123741023) has the molecular formula C20H20ClNO5S and a molecular weight of 421.90 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 123741023 |
| Molecular Formula | C20H20ClNO5S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20ClNO5S/c1-10-17(23)18(24)19(25)20(27-10)11-4-5-13(21)12(7-11)8-16-22-9-15(28-16)14-3-2-6-26-14/h2-7,9-10,17-20,23-25H,8H2,1H3/t10-,17-,18-,19-,20+/m1/s1 |
| InChIKey | JJXSOWGCBMOKAN-LBLCQNMJSA-N |
| XLogP | 3.19 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |