About [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene
[1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene (PubChem CID 123741441) has the molecular formula C6H7F3N4
and a molecular weight of 192.14 g/mol. Its IUPAC name is [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene.
Molecular Properties
| Compound Name | [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene |
| PubChem CID | 123741441 |
| Molecular Formula | C6H7F3N4 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene |
| SMILES | [H]/N=N/c1c(C(F)(F)F)c(C)nn1C |
| InChI | InChI=1S/C6H7F3N4/c1-3-4(6(7,8)9)5(11-10)13(2)12-3/h10H,1-2H3/b11-10+ |
| InChIKey | KGRHZRRXBIIWMA-ZHACJKMWSA-N |
| XLogP | 2.41 |
| TPSA | 54.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene?
The IUPAC name of [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene (CID 123741441) is [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene.
What is the SMILES notation for [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene?
The canonical SMILES for [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene is [H]/N=N/c1c(C(F)(F)F)c(C)nn1C.
What is the InChIKey of [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene?
The InChIKey is KGRHZRRXBIIWMA-ZHACJKMWSA-N. The full InChI is InChI=1S/C6H7F3N4/c1-3-4(6(7,8)9)5(11-10)13(2)12-3/h10H,1-2H3/b11-10+.
What are the key properties of [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene?
[1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene has a molecular weight of 192.14 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dimethyl-4-(trifluoromethyl)pyrazol-5-yl]diazene is sourced from PubChem (CID 123741441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).