About [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate
[4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate (PubChem CID 123741657) has the molecular formula C18H33N3O4
and a molecular weight of 355.48 g/mol. Its IUPAC name is [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate |
| PubChem CID | 123741657 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)C(C)C(NC=O)C(C)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C18H33N3O4/c1-12(2)18(24)25-15(5)13(3)16(19-11-22)14(4)17(23)21-9-7-20(6)8-10-21/h11-16H,7-10H2,1-6H3,(H,19,22) |
| InChIKey | ZSOUGIPMBDIJFT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate?
The IUPAC name of [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate (CID 123741657) is [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate.
What is the SMILES notation for [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate?
The canonical SMILES for [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate is CC(C)C(=O)OC(C)C(C)C(NC=O)C(C)C(=O)N1CCN(C)CC1.
What is the InChIKey of [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate?
The InChIKey is ZSOUGIPMBDIJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O4/c1-12(2)18(24)25-15(5)13(3)16(19-11-22)14(4)17(23)21-9-7-20(6)8-10-21/h11-16H,7-10H2,1-6H3,(H,19,22).
What are the key properties of [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate?
[4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate has a molecular weight of 355.48 g/mol, XLogP of 0.73, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-formamido-3,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohexan-2-yl] 2-methylpropanoate is sourced from PubChem (CID 123741657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).