C13H17F2NO2S — CID 123741698
2-[(2,4-dimethoxyphenyl)methyl]-6,6-difluorothiazinane (PubChem CID 123741698) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-6,6-difluorothiazinane.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-6,6-difluorothiazinane |
|---|---|
| PubChem CID | 123741698 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-6,6-difluorothiazinane |
| SMILES | COc1ccc(CN2CCCC(F)(F)S2)c(OC)c1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-17-11-5-4-10(12(8-11)18-2)9-16-7-3-6-13(14,15)19-16/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | PJPVNJOSQMRSBF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|