C12H21N — CID 123741804
(4Z)-5-butan-2-yl-4-butylidene-2,3-dihydropyrrole (PubChem CID 123741804) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (4Z)-5-butan-2-yl-4-butylidene-2,3-dihydropyrrole.
| Compound Name | (4Z)-5-butan-2-yl-4-butylidene-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 123741804 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (4Z)-5-butan-2-yl-4-butylidene-2,3-dihydropyrrole |
| SMILES | CCC/C=C1/CCN=C1C(C)CC |
| InChI | InChI=1S/C12H21N/c1-4-6-7-11-8-9-13-12(11)10(3)5-2/h7,10H,4-6,8-9H2,1-3H3/b11-7- |
| InChIKey | MFXIXNNMNBJKLS-XFFZJAGNSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |