C57H44N8O4 — CID 123741959
4-[4-[15-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]butanenitrile (PubChem CID 123741959) has the molecular formula C57H44N8O4 and a molecular weight of 905.03 g/mol. Its IUPAC name is 4-[4-[15-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]butanenitrile.
| Compound Name | 4-[4-[15-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 123741959 |
| Molecular Formula | C57H44N8O4 |
| Molecular Weight | 905.03 g/mol |
| Exact Mass | 904.35 |
| IUPAC Name | 4-[4-[15-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]butanenitrile |
| SMILES | N#CCCCOc1ccc(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C57H44N8O4/c58-28-3-4-34-68-40-12-8-36(9-13-40)52-44-16-20-48(61-44)54(38-24-29-59-30-25-38)50-22-18-46(63-50)53(47-19-23-51(64-47)55(39-26-31-60-32-27-39)49-21-17-45(52)62-49)37-10-14-41(15-11-37)69-35-5-33-65-56(66)42-6-1-2-7-43(42)57(65)67/h1-2,6-27,29-32,61-64H,3-5,33-35H2 |
| InChIKey | NUBGVQLTZVWHNZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.03 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|