C20H25FN2O4 — CID 123742255
2-acetamido-N-[2-ethylidene-5-(3-fluorophenoxy)hexa-3,5-dienyl]-3-methoxypropanamide (PubChem CID 123742255) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-acetamido-N-[2-ethylidene-5-(3-fluorophenoxy)hexa-3,5-dienyl]-3-methoxypropanamide.
| Compound Name | 2-acetamido-N-[2-ethylidene-5-(3-fluorophenoxy)hexa-3,5-dienyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 123742255 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-acetamido-N-[2-ethylidene-5-(3-fluorophenoxy)hexa-3,5-dienyl]-3-methoxypropanamide |
| SMILES | C=C(C=CC(=CC)CNC(=O)C(COC)NC(C)=O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H25FN2O4/c1-5-16(12-22-20(25)19(13-26-4)23-15(3)24)10-9-14(2)27-18-8-6-7-17(21)11-18/h5-11,19H,2,12-13H2,1,3-4H3,(H,22,25)(H,23,24) |
| InChIKey | GFDFBUVZXNDDKJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|