C32H28N8O2S — CID 123742268
N-[4-[[4-[1,3-benzothiazol-2-yl(cyano)methyl]pyrimidin-2-yl]amino]phenyl]-3-[4-(dimethylamino)but-2-enoylamino]benzamide (PubChem CID 123742268) has the molecular formula C32H28N8O2S and a molecular weight of 588.70 g/mol. Its IUPAC name is N-[4-[[4-[1,3-benzothiazol-2-yl(cyano)methyl]pyrimidin-2-yl]amino]phenyl]-3-[4-(dimethylamino)but-2-enoylamino]benzamide.
| Compound Name | N-[4-[[4-[1,3-benzothiazol-2-yl(cyano)methyl]pyrimidin-2-yl]amino]phenyl]-3-[4-(dimethylamino)but-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 123742268 |
| Molecular Formula | C32H28N8O2S |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | N-[4-[[4-[1,3-benzothiazol-2-yl(cyano)methyl]pyrimidin-2-yl]amino]phenyl]-3-[4-(dimethylamino)but-2-enoylamino]benzamide |
| SMILES | CN(C)CC=CC(=O)Nc1cccc(C(=O)Nc2ccc(Nc3nccc(C(C#N)c4nc5ccccc5s4)n3)cc2)c1 |
| InChI | InChI=1S/C32H28N8O2S/c1-40(2)18-6-11-29(41)35-24-8-5-7-21(19-24)30(42)36-22-12-14-23(15-13-22)37-32-34-17-16-26(39-32)25(20-33)31-38-27-9-3-4-10-28(27)43-31/h3-17,19,25H,18H2,1-2H3,(H,35,41)(H,36,42)(H,34,37,39) |
| InChIKey | XLLHFYYRDKVYSQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|