C42H34N4S+2 — CID 123742281
1,11-dimethyl-N-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]-N-phenylpyrazolo[1,5-f]phenanthridin-1-ium-10-amine (PubChem CID 123742281) has the molecular formula C42H34N4S+2 and a molecular weight of 626.83 g/mol. Its IUPAC name is 1,11-dimethyl-N-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]-N-phenylpyrazolo[1,5-f]phenanthridin-1-ium-10-amine.
| Compound Name | 1,11-dimethyl-N-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]-N-phenylpyrazolo[1,5-f]phenanthridin-1-ium-10-amine |
|---|---|
| PubChem CID | 123742281 |
| Molecular Formula | C42H34N4S+2 |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 1,11-dimethyl-N-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]-N-phenylpyrazolo[1,5-f]phenanthridin-1-ium-10-amine |
| SMILES | Cc1ccc2c(sc3ccccc32)c1-c1cccc(N(c2ccccc2)c2ccc3c4ccccc4c4cc[n+](C)n4c3c2C)[n+]1C |
| InChI | InChI=1S/C42H34N4S/c1-27-21-22-34-32-17-10-11-19-38(32)47-42(34)40(27)37-18-12-20-39(44(37)4)45(29-13-6-5-7-14-29)35-24-23-33-30-15-8-9-16-31(30)36-25-26-43(3)46(36)41(33)28(35)2/h5-26H,1-4H3/q+2 |
| InChIKey | PNZMADYWEHYGKQ-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 15.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|