C20H23ClO2 — CID 123742457
2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol (PubChem CID 123742457) has the molecular formula C20H23ClO2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol.
| Compound Name | 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 123742457 |
| Molecular Formula | C20H23ClO2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol |
| SMILES | CC(C)(C)[C@H]1CC=C(c2c(Cl)c(O)c3ccccc3c2O)CC1 |
| InChI | InChI=1S/C20H23ClO2/c1-20(2,3)13-10-8-12(9-11-13)16-17(21)19(23)15-7-5-4-6-14(15)18(16)22/h4-8,13,22-23H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | KSYQYGDANWCYCC-ZDUSSCGKSA-N |
| XLogP | 6.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|