About 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol
2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol (PubChem CID 123742457) has the molecular formula C20H23ClO2
and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol |
| PubChem CID | 123742457 |
| Molecular Formula | C20H23ClO2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol |
| SMILES | CC(C)(C)[C@H]1CC=C(c2c(Cl)c(O)c3ccccc3c2O)CC1 |
| InChI | InChI=1S/C20H23ClO2/c1-20(2,3)13-10-8-12(9-11-13)16-17(21)19(23)15-7-5-4-6-14(15)18(16)22/h4-8,13,22-23H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | KSYQYGDANWCYCC-ZDUSSCGKSA-N |
| XLogP | 6.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol?
The IUPAC name of 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol (CID 123742457) is 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol.
What is the SMILES notation for 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol?
The canonical SMILES for 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol is CC(C)(C)[C@H]1CC=C(c2c(Cl)c(O)c3ccccc3c2O)CC1.
What is the InChIKey of 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol?
The InChIKey is KSYQYGDANWCYCC-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H23ClO2/c1-20(2,3)13-10-8-12(9-11-13)16-17(21)19(23)15-7-5-4-6-14(15)18(16)22/h4-8,13,22-23H,9-11H2,1-3H3/t13-/m0/s1.
What are the key properties of 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol?
2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol has a molecular weight of 330.86 g/mol, XLogP of 6.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-4-tert-butylcyclohexen-1-yl]-3-chloronaphthalene-1,4-diol is sourced from PubChem (CID 123742457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).