C18H33N — CID 123742804
9-butyl-3-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-amine (PubChem CID 123742804) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 9-butyl-3-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-amine.
| Compound Name | 9-butyl-3-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-amine |
|---|---|
| PubChem CID | 123742804 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 9-butyl-3-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-amine |
| SMILES | CCCCC1(N)C2CCCCC2C2CC(C)CCC21 |
| InChI | InChI=1S/C18H33N/c1-3-4-11-18(19)16-8-6-5-7-14(16)15-12-13(2)9-10-17(15)18/h13-17H,3-12,19H2,1-2H3 |
| InChIKey | FZFTWYCKVFKQEV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |