C33H29BrN2O3 — CID 123742898
2-[4-[[5-[3-[(4-bromophenyl)methylamino]oxiran-2-yl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 123742898) has the molecular formula C33H29BrN2O3 and a molecular weight of 581.51 g/mol. Its IUPAC name is 2-[4-[[5-[3-[(4-bromophenyl)methylamino]oxiran-2-yl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[3-[(4-bromophenyl)methylamino]oxiran-2-yl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123742898 |
| Molecular Formula | C33H29BrN2O3 |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 2-[4-[[5-[3-[(4-bromophenyl)methylamino]oxiran-2-yl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C3OC3NCc3ccc(Br)cc3)cc12 |
| InChI | InChI=1S/C33H29BrN2O3/c1-20-21(2)36(19-23-7-11-24(12-8-23)27-5-3-4-6-28(27)33(37)38)30-16-13-25(17-29(20)30)31-32(39-31)35-18-22-9-14-26(34)15-10-22/h3-17,31-32,35H,18-19H2,1-2H3,(H,37,38) |
| InChIKey | XWNYNQQLUDUWCG-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|