C15H22N2O — CID 123743083
N'-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboximidamide (PubChem CID 123743083) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N'-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboximidamide.
| Compound Name | N'-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 123743083 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N'-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboximidamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(N)=NO)ccc21 |
| InChI | InChI=1S/C15H22N2O/c1-14(2)7-8-15(3,4)12-9-10(13(16)17-18)5-6-11(12)14/h5-6,9,18H,7-8H2,1-4H3,(H2,16,17) |
| InChIKey | LRSFPBTVSJSFJW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|