About benzene;4-propan-2-yl-3H-pyrrole
benzene;4-propan-2-yl-3H-pyrrole (PubChem CID 123743128) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is benzene;4-propan-2-yl-3H-pyrrole.
Molecular Properties
| Compound Name | benzene;4-propan-2-yl-3H-pyrrole |
| PubChem CID | 123743128 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | benzene;4-propan-2-yl-3H-pyrrole |
| SMILES | CC(C)C1=CN=CC1.c1ccccc1 |
| InChI | InChI=1S/C7H11N.C6H6/c1-6(2)7-3-4-8-5-7;1-2-4-6-5-3-1/h4-6H,3H2,1-2H3;1-6H |
| InChIKey | XWRFESCRWOVVSW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;4-propan-2-yl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-propan-2-yl-3H-pyrrole?
The IUPAC name of benzene;4-propan-2-yl-3H-pyrrole (CID 123743128) is benzene;4-propan-2-yl-3H-pyrrole.
What is the SMILES notation for benzene;4-propan-2-yl-3H-pyrrole?
The canonical SMILES for benzene;4-propan-2-yl-3H-pyrrole is CC(C)C1=CN=CC1.c1ccccc1.
What is the InChIKey of benzene;4-propan-2-yl-3H-pyrrole?
The InChIKey is XWRFESCRWOVVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C6H6/c1-6(2)7-3-4-8-5-7;1-2-4-6-5-3-1/h4-6H,3H2,1-2H3;1-6H.
What are the key properties of benzene;4-propan-2-yl-3H-pyrrole?
benzene;4-propan-2-yl-3H-pyrrole has a molecular weight of 187.29 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-propan-2-yl-3H-pyrrole is sourced from PubChem (CID 123743128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).