About 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine
8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine (PubChem CID 123743235) has the molecular formula C17H35N3
and a molecular weight of 281.49 g/mol. Its IUPAC name is 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine.
Molecular Properties
| Compound Name | 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine |
| PubChem CID | 123743235 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine |
| SMILES | C=C(CCN)C(CCN)CCCC=CCCNCCC |
| InChI | InChI=1S/C17H35N3/c1-3-14-20-15-8-6-4-5-7-9-17(11-13-19)16(2)10-12-18/h4,6,17,20H,2-3,5,7-15,18-19H2,1H3 |
| InChIKey | PVLLTBZQKZIGHS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine?
The IUPAC name of 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine (CID 123743235) is 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine.
What is the SMILES notation for 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine?
The canonical SMILES for 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine is C=C(CCN)C(CCN)CCCC=CCCNCCC.
What is the InChIKey of 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine?
The InChIKey is PVLLTBZQKZIGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3/c1-3-14-20-15-8-6-4-5-7-9-17(11-13-19)16(2)10-12-18/h4,6,17,20H,2-3,5,7-15,18-19H2,1H3.
What are the key properties of 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine?
8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine has a molecular weight of 281.49 g/mol, XLogP of 2.97, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminoethyl)-9-methylidene-N-propylundec-3-ene-1,11-diamine is sourced from PubChem (CID 123743235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).