C27H27N9O — CID 123743306
7-[ethanimidoyl(methanimidoyl)amino]-N-[3-ethyl-1-[(6-methyl-2-pyridinyl)methyl]indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 123743306) has the molecular formula C27H27N9O and a molecular weight of 493.58 g/mol. Its IUPAC name is 7-[ethanimidoyl(methanimidoyl)amino]-N-[3-ethyl-1-[(6-methyl-2-pyridinyl)methyl]indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 7-[ethanimidoyl(methanimidoyl)amino]-N-[3-ethyl-1-[(6-methyl-2-pyridinyl)methyl]indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123743306 |
| Molecular Formula | C27H27N9O |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 7-[ethanimidoyl(methanimidoyl)amino]-N-[3-ethyl-1-[(6-methyl-2-pyridinyl)methyl]indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | [H]/N=C/N(/C(C)=N/[H])c1ccn2c(C(=O)Nc3cccc4c3c(CC)nn4Cc3cccc(C)n3)cnc2c1 |
| InChI | InChI=1S/C27H27N9O/c1-4-21-26-22(9-6-10-23(26)36(33-21)15-19-8-5-7-17(2)31-19)32-27(37)24-14-30-25-13-20(11-12-34(24)25)35(16-28)18(3)29/h5-14,16,28-29H,4,15H2,1-3H3,(H,32,37)/b28-16+,29-18+ |
| InChIKey | QMTQCHUOJCTVIE-NWOYDJGMSA-N |
| XLogP | 4.66 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|