About spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one
spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one (PubChem CID 123743349) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one.
Molecular Properties
| Compound Name | spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one |
| PubChem CID | 123743349 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one |
| SMILES | O=C1COC2(CC=Cc3ccccc32)N1 |
| InChI | InChI=1S/C12H11NO2/c14-11-8-15-12(13-11)7-3-5-9-4-1-2-6-10(9)12/h1-6H,7-8H2,(H,13,14) |
| InChIKey | SOVWNDXIDXMIJG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one?
The IUPAC name of spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one (CID 123743349) is spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one.
What is the SMILES notation for spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one?
The canonical SMILES for spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one is O=C1COC2(CC=Cc3ccccc32)N1.
What is the InChIKey of spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one?
The InChIKey is SOVWNDXIDXMIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-11-8-15-12(13-11)7-3-5-9-4-1-2-6-10(9)12/h1-6H,7-8H2,(H,13,14).
What are the key properties of spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one?
spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one has a molecular weight of 201.23 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-oxazolidine-2,1'-2H-naphthalene]-4-one is sourced from PubChem (CID 123743349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).