About 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide
4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide (PubChem CID 123743489) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide |
| PubChem CID | 123743489 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide |
| SMILES | C=CC=CN(Cc1ccc(C(=O)NO)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-2-3-13-20(17-7-5-4-6-8-17)14-15-9-11-16(12-10-15)18(21)19-22/h2-13,22H,1,14H2,(H,19,21) |
| InChIKey | CHMXIAFDZWRJRL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide (CID 123743489) is 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide is C=CC=CN(Cc1ccc(C(=O)NO)cc1)c1ccccc1.
What is the InChIKey of 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide?
The InChIKey is CHMXIAFDZWRJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-2-3-13-20(17-7-5-4-6-8-17)14-15-9-11-16(12-10-15)18(21)19-22/h2-13,22H,1,14H2,(H,19,21).
What are the key properties of 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide?
4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide has a molecular weight of 294.35 g/mol, XLogP of 3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(N-buta-1,3-dienylanilino)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 123743489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).