C20H21NO3 — CID 123743961
3-(cyclopropen-1-ylmethyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 123743961) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-(cyclopropen-1-ylmethyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | 3-(cyclopropen-1-ylmethyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 123743961 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-(cyclopropen-1-ylmethyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | Oc1ccc2c3c1OC1C(O)C=CC4C(C2)N(CC2=CC2)CCC341 |
| InChI | InChI=1S/C20H21NO3/c22-15-5-3-12-9-14-13-4-6-16(23)19-20(13,17(12)18(15)24-19)7-8-21(14)10-11-1-2-11/h1,3-6,13-14,16,19,22-23H,2,7-10H2 |
| InChIKey | FCXJEMNEDCQUQR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|