About 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline
6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline (PubChem CID 123744139) has the molecular formula C20H20F3N
and a molecular weight of 331.38 g/mol. Its IUPAC name is 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline |
| PubChem CID | 123744139 |
| Molecular Formula | C20H20F3N |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline |
| SMILES | Cc1cc2c(cc1C)C(CCc1ccc(C(F)(F)F)cc1)=NCC2 |
| InChI | InChI=1S/C20H20F3N/c1-13-11-16-9-10-24-19(18(16)12-14(13)2)8-5-15-3-6-17(7-4-15)20(21,22)23/h3-4,6-7,11-12H,5,8-10H2,1-2H3 |
| InChIKey | NHSMXIWVBLEEEJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline?
The IUPAC name of 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline (CID 123744139) is 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline is Cc1cc2c(cc1C)C(CCc1ccc(C(F)(F)F)cc1)=NCC2.
What is the InChIKey of 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline?
The InChIKey is NHSMXIWVBLEEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N/c1-13-11-16-9-10-24-19(18(16)12-14(13)2)8-5-15-3-6-17(7-4-15)20(21,22)23/h3-4,6-7,11-12H,5,8-10H2,1-2H3.
What are the key properties of 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline?
6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline has a molecular weight of 331.38 g/mol, XLogP of 5.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 123744139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).