C20H23BrO — CID 123744207
6-bromo-2-(4-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl)-3,4-dihydro-2H-chromene (PubChem CID 123744207) has the molecular formula C20H23BrO and a molecular weight of 359.31 g/mol. Its IUPAC name is 6-bromo-2-(4-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-bromo-2-(4-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 123744207 |
| Molecular Formula | C20H23BrO |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-bromo-2-(4-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl)-3,4-dihydro-2H-chromene |
| SMILES | C=C(C)C(=CC)C(C)=CC(=C)C1CCc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C20H23BrO/c1-6-18(13(2)3)14(4)11-15(5)19-9-7-16-12-17(21)8-10-20(16)22-19/h6,8,10-12,19H,2,5,7,9H2,1,3-4H3 |
| InChIKey | LRANWWULECFETA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|