C27H26ClNO7 — CID 123744221
methyl 7-chloro-4,6-dimethoxy-7'-methyl-3,5'-dioxo-4'-phenylspiro[1-benzofuran-2,6'-2,3,4,4a,7,8-hexahydroquinoline]-2'-carboxylate (PubChem CID 123744221) has the molecular formula C27H26ClNO7 and a molecular weight of 511.96 g/mol. Its IUPAC name is methyl 7-chloro-4,6-dimethoxy-7'-methyl-3,5'-dioxo-4'-phenylspiro[1-benzofuran-2,6'-2,3,4,4a,7,8-hexahydroquinoline]-2'-carboxylate.
| Compound Name | methyl 7-chloro-4,6-dimethoxy-7'-methyl-3,5'-dioxo-4'-phenylspiro[1-benzofuran-2,6'-2,3,4,4a,7,8-hexahydroquinoline]-2'-carboxylate |
|---|---|
| PubChem CID | 123744221 |
| Molecular Formula | C27H26ClNO7 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | methyl 7-chloro-4,6-dimethoxy-7'-methyl-3,5'-dioxo-4'-phenylspiro[1-benzofuran-2,6'-2,3,4,4a,7,8-hexahydroquinoline]-2'-carboxylate |
| SMILES | COC(=O)C1CC(c2ccccc2)C2C(=O)C3(Oc4c(Cl)c(OC)cc(OC)c4C3=O)C(C)CC2=N1 |
| InChI | InChI=1S/C27H26ClNO7/c1-13-10-16-20(15(14-8-6-5-7-9-14)11-17(29-16)26(32)35-4)24(30)27(13)25(31)21-18(33-2)12-19(34-3)22(28)23(21)36-27/h5-9,12-13,15,17,20H,10-11H2,1-4H3 |
| InChIKey | NIZYGDKEOZZFOR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|