About [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate
[4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate (PubChem CID 123744465) has the molecular formula C30H31NO4
and a molecular weight of 469.58 g/mol. Its IUPAC name is [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate |
| PubChem CID | 123744465 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)Oc1ccc(N(c2ccc(OC(=O)C(C)=CC)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C30H31NO4/c1-7-20(3)29(32)34-27-15-11-24(12-16-27)31(26-10-9-22(5)23(6)19-26)25-13-17-28(18-14-25)35-30(33)21(4)8-2/h7-19H,1-6H3 |
| InChIKey | MVDSSOGRQSFDGL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate?
The IUPAC name of [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate (CID 123744465) is [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate.
What is the SMILES notation for [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate?
The canonical SMILES for [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate is CC=C(C)C(=O)Oc1ccc(N(c2ccc(OC(=O)C(C)=CC)cc2)c2ccc(C)c(C)c2)cc1.
What is the InChIKey of [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate?
The InChIKey is MVDSSOGRQSFDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31NO4/c1-7-20(3)29(32)34-27-15-11-24(12-16-27)31(26-10-9-22(5)23(6)19-26)25-13-17-28(18-14-25)35-30(33)21(4)8-2/h7-19H,1-6H3.
What are the key properties of [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate?
[4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate has a molecular weight of 469.58 g/mol, XLogP of 7.52, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[N-(3,4-dimethylphenyl)-4-(2-methylbut-2-enoyloxy)anilino]phenyl] 2-methylbut-2-enoate is sourced from PubChem (CID 123744465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).