About [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate
[4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate (PubChem CID 123744515) has the molecular formula C22H24F4N2O3
and a molecular weight of 440.44 g/mol. Its IUPAC name is [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate |
| PubChem CID | 123744515 |
| Molecular Formula | C22H24F4N2O3 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate |
| SMILES | CC(CCc1ccc(OC(=O)N(C)C)c(OC(F)(F)F)c1)N1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C22H24F4N2O3/c1-14(28-12-16-7-8-18(23)11-17(16)13-28)4-5-15-6-9-19(30-21(29)27(2)3)20(10-15)31-22(24,25)26/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | JWOJDKMHSKNBEA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate?
The IUPAC name of [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate (CID 123744515) is [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate?
The canonical SMILES for [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate is CC(CCc1ccc(OC(=O)N(C)C)c(OC(F)(F)F)c1)N1Cc2ccc(F)cc2C1.
What is the InChIKey of [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate?
The InChIKey is JWOJDKMHSKNBEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F4N2O3/c1-14(28-12-16-7-8-18(23)11-17(16)13-28)4-5-15-6-9-19(30-21(29)27(2)3)20(10-15)31-22(24,25)26/h6-11,14H,4-5,12-13H2,1-3H3.
What are the key properties of [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate?
[4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate has a molecular weight of 440.44 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-(trifluoromethoxy)phenyl] N,N-dimethylcarbamate is sourced from PubChem (CID 123744515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).