C16H26N2O2S — CID 123744709
ethyl 3-methyl-5-(1-pyridin-2-ylsulfanylpropan-2-ylamino)pentanoate (PubChem CID 123744709) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is ethyl 3-methyl-5-(1-pyridin-2-ylsulfanylpropan-2-ylamino)pentanoate.
| Compound Name | ethyl 3-methyl-5-(1-pyridin-2-ylsulfanylpropan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 123744709 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl 3-methyl-5-(1-pyridin-2-ylsulfanylpropan-2-ylamino)pentanoate |
| SMILES | CCOC(=O)CC(C)CCNC(C)CSc1ccccn1 |
| InChI | InChI=1S/C16H26N2O2S/c1-4-20-16(19)11-13(2)8-10-17-14(3)12-21-15-7-5-6-9-18-15/h5-7,9,13-14,17H,4,8,10-12H2,1-3H3 |
| InChIKey | LXGUDLQBVNZTCS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |