About dimethyl oxolane-2,3-dicarboxylate
dimethyl oxolane-2,3-dicarboxylate (PubChem CID 123744712) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is dimethyl oxolane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl oxolane-2,3-dicarboxylate |
| PubChem CID | 123744712 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | dimethyl oxolane-2,3-dicarboxylate |
| SMILES | COC(=O)C1CCOC1C(=O)OC |
| InChI | InChI=1S/C8H12O5/c1-11-7(9)5-3-4-13-6(5)8(10)12-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | UEGFNIFJJUOLBM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl oxolane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl oxolane-2,3-dicarboxylate?
The IUPAC name of dimethyl oxolane-2,3-dicarboxylate (CID 123744712) is dimethyl oxolane-2,3-dicarboxylate.
What is the SMILES notation for dimethyl oxolane-2,3-dicarboxylate?
The canonical SMILES for dimethyl oxolane-2,3-dicarboxylate is COC(=O)C1CCOC1C(=O)OC.
What is the InChIKey of dimethyl oxolane-2,3-dicarboxylate?
The InChIKey is UEGFNIFJJUOLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-11-7(9)5-3-4-13-6(5)8(10)12-2/h5-6H,3-4H2,1-2H3.
What are the key properties of dimethyl oxolane-2,3-dicarboxylate?
dimethyl oxolane-2,3-dicarboxylate has a molecular weight of 188.18 g/mol, XLogP of -0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl oxolane-2,3-dicarboxylate is sourced from PubChem (CID 123744712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).