C28H42Cl2N2O5 — CID 123744820
tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate;tert-butyl N-[(1R)-1-phenylpropyl]carbamate;dichloromethane (PubChem CID 123744820) has the molecular formula C28H42Cl2N2O5 and a molecular weight of 557.56 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate;tert-butyl N-[(1R)-1-phenylpropyl]carbamate;dichloromethane.
| Compound Name | tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate;tert-butyl N-[(1R)-1-phenylpropyl]carbamate;dichloromethane |
|---|---|
| PubChem CID | 123744820 |
| Molecular Formula | C28H42Cl2N2O5 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate;tert-butyl N-[(1R)-1-phenylpropyl]carbamate;dichloromethane |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)c1ccccc1.CC[C@@H](NC(=O)OC(C)(C)C)c1ccccc1.ClCCl |
| InChI | InChI=1S/C14H21NO2.C13H19NO3.CH2Cl2/c1-5-12(11-9-7-6-8-10-11)15-13(16)17-14(2,3)4;1-13(2,3)17-12(16)14-11(9-15)10-7-5-4-6-8-10;2-1-3/h6-10,12H,5H2,1-4H3,(H,15,16);4-8,11,15H,9H2,1-3H3,(H,14,16);1H2/t12-;11-;/m11./s1 |
| InChIKey | XPJYWBDEHYGNIG-BFRNMVGLSA-N |
| XLogP | 7.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|