C27H44F6O5 — CID 123745162
[2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123745162) has the molecular formula C27H44F6O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123745162 |
| Molecular Formula | C27H44F6O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC1CCC2OC(C)(CCCOC(C(F)(F)F)C(F)(F)F)OC2C1)C(C)(C)C |
| InChI | InChI=1S/C27H44F6O5/c1-22(2,3)16-24(7,23(4,5)6)21(34)36-15-17-10-11-18-19(14-17)38-25(8,37-18)12-9-13-35-20(26(28,29)30)27(31,32)33/h17-20H,9-16H2,1-8H3 |
| InChIKey | KSBUPXWBIXVGTC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|