C11H18F2N4O3 — CID 123745333
4,4-difluoro-N-[3-(methylamino)propoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 123745333) has the molecular formula C11H18F2N4O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4,4-difluoro-N-[3-(methylamino)propoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | 4,4-difluoro-N-[3-(methylamino)propoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 123745333 |
| Molecular Formula | C11H18F2N4O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4,4-difluoro-N-[3-(methylamino)propoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CNCCCONC(=O)C1CC(F)(F)C2CN1C(=O)N2 |
| InChI | InChI=1S/C11H18F2N4O3/c1-14-3-2-4-20-16-9(18)7-5-11(12,13)8-6-17(7)10(19)15-8/h7-8,14H,2-6H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | MKCLFPWXGSZAAO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|