C9H11F2NO4 — CID 123745865
3-(1,1-difluoroprop-2-enyl)pyrrolidine-1,3-dicarboxylic acid (PubChem CID 123745865) has the molecular formula C9H11F2NO4 and a molecular weight of 235.19 g/mol. Its IUPAC name is 3-(1,1-difluoroprop-2-enyl)pyrrolidine-1,3-dicarboxylic acid.
| Compound Name | 3-(1,1-difluoroprop-2-enyl)pyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 123745865 |
| Molecular Formula | C9H11F2NO4 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-(1,1-difluoroprop-2-enyl)pyrrolidine-1,3-dicarboxylic acid |
| SMILES | C=CC(F)(F)C1(C(=O)O)CCN(C(=O)O)C1 |
| InChI | InChI=1S/C9H11F2NO4/c1-2-9(10,11)8(6(13)14)3-4-12(5-8)7(15)16/h2H,1,3-5H2,(H,13,14)(H,15,16) |
| InChIKey | MPAHJDBUEWAGJZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|