C15H28N2O — CID 123746046
3-(4,5,6-trimethyl-4H-pyran-2-yl)heptylhydrazine (PubChem CID 123746046) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-(4,5,6-trimethyl-4H-pyran-2-yl)heptylhydrazine.
| Compound Name | 3-(4,5,6-trimethyl-4H-pyran-2-yl)heptylhydrazine |
|---|---|
| PubChem CID | 123746046 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 3-(4,5,6-trimethyl-4H-pyran-2-yl)heptylhydrazine |
| SMILES | CCCCC(CCNN)C1=CC(C)C(C)=C(C)O1 |
| InChI | InChI=1S/C15H28N2O/c1-5-6-7-14(8-9-17-16)15-10-11(2)12(3)13(4)18-15/h10-11,14,17H,5-9,16H2,1-4H3 |
| InChIKey | VYHNRWPRZDVURY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|