About 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol
2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol (PubChem CID 123746276) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol |
| PubChem CID | 123746276 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol |
| SMILES | CCCCCCCC1=NCC(CCO)N1 |
| InChI | InChI=1S/C12H24N2O/c1-2-3-4-5-6-7-12-13-10-11(14-12)8-9-15/h11,15H,2-10H2,1H3,(H,13,14) |
| InChIKey | NAHFELOYQAWPMC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol?
The IUPAC name of 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol (CID 123746276) is 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol.
What is the SMILES notation for 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol?
The canonical SMILES for 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol is CCCCCCCC1=NCC(CCO)N1.
What is the InChIKey of 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol?
The InChIKey is NAHFELOYQAWPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-2-3-4-5-6-7-12-13-10-11(14-12)8-9-15/h11,15H,2-10H2,1H3,(H,13,14).
What are the key properties of 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol?
2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol has a molecular weight of 212.34 g/mol, XLogP of 2.10, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-heptyl-4,5-dihydro-1H-imidazol-5-yl)ethanol is sourced from PubChem (CID 123746276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).