C28H53FN7O2+ — CID 123746541
1-[3-[[3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 123746541) has the molecular formula C28H53FN7O2+ and a molecular weight of 538.78 g/mol. Its IUPAC name is 1-[3-[[3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[[3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 123746541 |
| Molecular Formula | C28H53FN7O2+ |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | 1-[3-[[3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CCC1(C)CCCC(F)/C=[N+](/C)C(C(C(=O)NC2CNCCC2N2CCCC(C(=O)N(C)C)C2)C(N)N)C1 |
| InChI | InChI=1S/C28H52FN7O2/c1-6-28(2)12-7-10-20(29)18-35(5)23(15-28)24(25(30)31)26(37)33-21-16-32-13-11-22(21)36-14-8-9-19(17-36)27(38)34(3)4/h18-25,32H,6-17,30-31H2,1-5H3/p+1/b35-18- |
| InChIKey | MPIWYWCERAAEFF-AEUUOICLSA-O |
| XLogP | 0.90 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|