C14H16N2O — CID 123747004
2,10-diazatetracyclo[10.4.0.02,4.06,10]hexadeca-1(16),12,14-trien-11-one (PubChem CID 123747004) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 2,10-diazatetracyclo[10.4.0.02,4.06,10]hexadeca-1(16),12,14-trien-11-one.
| Compound Name | 2,10-diazatetracyclo[10.4.0.02,4.06,10]hexadeca-1(16),12,14-trien-11-one |
|---|---|
| PubChem CID | 123747004 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2,10-diazatetracyclo[10.4.0.02,4.06,10]hexadeca-1(16),12,14-trien-11-one |
| SMILES | O=C1c2ccccc2N2CC2CC2CCCN12 |
| InChI | InChI=1S/C14H16N2O/c17-14-12-5-1-2-6-13(12)16-9-11(16)8-10-4-3-7-15(10)14/h1-2,5-6,10-11H,3-4,7-9H2 |
| InChIKey | NYHGJVHLJUCYSB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|