C19H38O2P+ — CID 123747747
7,7,9,9-tetraethyl-6,8,8,10-tetramethyl-1,4-dioxa-8-phosphoniaspiro[4.5]decane (PubChem CID 123747747) has the molecular formula C19H38O2P+ and a molecular weight of 329.49 g/mol. Its IUPAC name is 7,7,9,9-tetraethyl-6,8,8,10-tetramethyl-1,4-dioxa-8-phosphoniaspiro[4.5]decane.
| Compound Name | 7,7,9,9-tetraethyl-6,8,8,10-tetramethyl-1,4-dioxa-8-phosphoniaspiro[4.5]decane |
|---|---|
| PubChem CID | 123747747 |
| Molecular Formula | C19H38O2P+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 7,7,9,9-tetraethyl-6,8,8,10-tetramethyl-1,4-dioxa-8-phosphoniaspiro[4.5]decane |
| SMILES | CCC1(CC)C(C)C2(OCCO2)C(C)C(CC)(CC)[P+]1(C)C |
| InChI | InChI=1S/C19H38O2P/c1-9-17(10-2)15(5)19(20-13-14-21-19)16(6)18(11-3,12-4)22(17,7)8/h15-16H,9-14H2,1-8H3/q+1 |
| InChIKey | GWSJUTOZFIIIIQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|