About N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide
N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide (PubChem CID 123748304) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide |
| PubChem CID | 123748304 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide |
| SMILES | CCC(C)=C(C)C(=O)NCC(C)(C)NC(=O)C(C)O |
| InChI | InChI=1S/C14H26N2O3/c1-7-9(2)10(3)12(18)15-8-14(5,6)16-13(19)11(4)17/h11,17H,7-8H2,1-6H3,(H,15,18)(H,16,19) |
| InChIKey | QSUXLMPGCYEQMM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide?
The IUPAC name of N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide (CID 123748304) is N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide.
What is the SMILES notation for N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide?
The canonical SMILES for N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide is CCC(C)=C(C)C(=O)NCC(C)(C)NC(=O)C(C)O.
What is the InChIKey of N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide?
The InChIKey is QSUXLMPGCYEQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-7-9(2)10(3)12(18)15-8-14(5,6)16-13(19)11(4)17/h11,17H,7-8H2,1-6H3,(H,15,18)(H,16,19).
What are the key properties of N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide?
N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide has a molecular weight of 270.37 g/mol, XLogP of 1.12, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-hydroxypropanoylamino)-2-methylpropyl]-2,3-dimethylpent-2-enamide is sourced from PubChem (CID 123748304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).