C8H10N2O — CID 123748950
7-iminocyclohepta-1,5-diene-1-carboxamide (PubChem CID 123748950) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-iminocyclohepta-1,5-diene-1-carboxamide.
| Compound Name | 7-iminocyclohepta-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 123748950 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 7-iminocyclohepta-1,5-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CCCC=C1C(N)=O |
| InChI | InChI=1S/C8H10N2O/c9-7-5-3-1-2-4-6(7)8(10)11/h3-5,9H,1-2H2,(H2,10,11)/b9-7+ |
| InChIKey | BCMHOPITSDHEDU-VQHVLOKHSA-N |
| XLogP | 0.77 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|