C26H32N2O5 — CID 123749142
ethyl 3-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methylphenyl]methylamino]-3-(4-methylphenyl)propanoate (PubChem CID 123749142) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 3-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methylphenyl]methylamino]-3-(4-methylphenyl)propanoate.
| Compound Name | ethyl 3-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methylphenyl]methylamino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 123749142 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl 3-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methylphenyl]methylamino]-3-(4-methylphenyl)propanoate |
| SMILES | CCOC(=O)CC(NCc1ccc(OCCn2c(O)ccc2O)c(C)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-4-32-26(31)16-22(21-8-5-18(2)6-9-21)27-17-20-7-10-23(19(3)15-20)33-14-13-28-24(29)11-12-25(28)30/h5-12,15,22,27,29-30H,4,13-14,16-17H2,1-3H3 |
| InChIKey | UKFCPQYUXHFQSG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|