C25H27NO3S2 — CID 123749695
3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenyl-2,3-dihydrofuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123749695) has the molecular formula C25H27NO3S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenyl-2,3-dihydrofuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenyl-2,3-dihydrofuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123749695 |
| Molecular Formula | C25H27NO3S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenyl-2,3-dihydrofuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=CC2OC(c3ccccc3)=CC2CO)SC(=S)N1C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H27NO3S2/c27-13-19-11-20(16-4-2-1-3-5-16)29-21(19)12-22-24(28)26(25(30)31-22)23-17-7-14-6-15(9-17)10-18(23)8-14/h1-5,11-12,14-15,17-19,21,23,27H,6-10,13H2 |
| InChIKey | LLQMMAWCTKTIOT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|